C14H27NO4 — CID 28721496
N-[3-(2-methoxyethoxy)propyl]-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 28721496) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is N-[3-(2-methoxyethoxy)propyl]-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-[3-(2-methoxyethoxy)propyl]-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 28721496 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | N-[3-(2-methoxyethoxy)propyl]-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | COCCOCCCNC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H27NO4/c1-16-9-10-17-8-2-7-15-13-3-5-14(6-4-13)18-11-12-19-14/h13,15H,2-12H2,1H3 |
| InChIKey | OELAAKRBNDXXGW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|