C14H25NO4 — CID 113414158
N-butan-2-yl-2-(1,4-dioxaspiro[4.5]decan-8-yloxy)acetamide (PubChem CID 113414158) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is N-butan-2-yl-2-(1,4-dioxaspiro[4.5]decan-8-yloxy)acetamide.
| Compound Name | N-butan-2-yl-2-(1,4-dioxaspiro[4.5]decan-8-yloxy)acetamide |
|---|---|
| PubChem CID | 113414158 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | N-butan-2-yl-2-(1,4-dioxaspiro[4.5]decan-8-yloxy)acetamide |
| SMILES | CCC(C)NC(=O)COC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H25NO4/c1-3-11(2)15-13(16)10-17-12-4-6-14(7-5-12)18-8-9-19-14/h11-12H,3-10H2,1-2H3,(H,15,16) |
| InChIKey | NWHTYRFNHIJFMP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |