C10H17NO5 — CID 119349069
2-[[2-(oxan-4-yloxy)acetyl]amino]propanoic acid (PubChem CID 119349069) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-[[2-(oxan-4-yloxy)acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-(oxan-4-yloxy)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119349069 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-[[2-(oxan-4-yloxy)acetyl]amino]propanoic acid |
| SMILES | CC(NC(=O)COC1CCOCC1)C(=O)O |
| InChI | InChI=1S/C10H17NO5/c1-7(10(13)14)11-9(12)6-16-8-2-4-15-5-3-8/h7-8H,2-6H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | YAFHOCCVPXBYSY-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |