C9H13ClO3 — CID 53440507
1,4-dioxaspiro[4.5]decane-8-carbonyl chloride (PubChem CID 53440507) has the molecular formula C9H13ClO3 and a molecular weight of 204.65 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.5]decane-8-carbonyl chloride.
| Compound Name | 1,4-dioxaspiro[4.5]decane-8-carbonyl chloride |
|---|---|
| PubChem CID | 53440507 |
| Molecular Formula | C9H13ClO3 |
| Molecular Weight | 204.65 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 1,4-dioxaspiro[4.5]decane-8-carbonyl chloride |
| SMILES | O=C(Cl)C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C9H13ClO3/c10-8(11)7-1-3-9(4-2-7)12-5-6-13-9/h7H,1-6H2 |
| InChIKey | RNVLYGFZBWJGTQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.65 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|