1,4-dioxaspiro[4.5]decane-8-carbonyl chloride

C9H13ClO3 — CID 53440507

IUPAC1,4-dioxaspiro[4.5]decane-8-carbonyl chloride
SMILESO=C(Cl)C1CCC2(CC1)OCCO2
InChIInChI=1S/C9H13ClO3/c10-8(11)7-1-3-9(4-2-7)12-5-6-13-9/h7H,1-6H2
InChIKeyRNVLYGFZBWJGTQ-UHFFFAOYSA-N
MW204.65 g/mol
LogP1.69
Rot. Bonds1

About 1,4-dioxaspiro[4.5]decane-8-carbonyl chloride

1,4-dioxaspiro[4.5]decane-8-carbonyl chloride (PubChem CID 53440507) has the molecular formula C9H13ClO3 and a molecular weight of 204.65 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.5]decane-8-carbonyl chloride.

Molecular Properties

Compound Name1,4-dioxaspiro[4.5]decane-8-carbonyl chloride
PubChem CID53440507
Molecular FormulaC9H13ClO3
Molecular Weight204.65 g/mol
Exact Mass204.06
IUPAC Name1,4-dioxaspiro[4.5]decane-8-carbonyl chloride
SMILESO=C(Cl)C1CCC2(CC1)OCCO2
InChIInChI=1S/C9H13ClO3/c10-8(11)7-1-3-9(4-2-7)12-5-6-13-9/h7H,1-6H2
InChIKeyRNVLYGFZBWJGTQ-UHFFFAOYSA-N
XLogP1.69
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.65
LogP ≤ 51.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1,4-dioxaspiro[4.5]decane-8-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-dioxaspiro[4.5]decane-8-carbonyl chloride?
The IUPAC name of 1,4-dioxaspiro[4.5]decane-8-carbonyl chloride (CID 53440507) is 1,4-dioxaspiro[4.5]decane-8-carbonyl chloride.
What is the SMILES notation for 1,4-dioxaspiro[4.5]decane-8-carbonyl chloride?
The canonical SMILES for 1,4-dioxaspiro[4.5]decane-8-carbonyl chloride is O=C(Cl)C1CCC2(CC1)OCCO2.
What is the InChIKey of 1,4-dioxaspiro[4.5]decane-8-carbonyl chloride?
The InChIKey is RNVLYGFZBWJGTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClO3/c10-8(11)7-1-3-9(4-2-7)12-5-6-13-9/h7H,1-6H2.
What are the key properties of 1,4-dioxaspiro[4.5]decane-8-carbonyl chloride?
1,4-dioxaspiro[4.5]decane-8-carbonyl chloride has a molecular weight of 204.65 g/mol, XLogP of 1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxaspiro[4.5]decane-8-carbonyl chloride is sourced from PubChem (CID 53440507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).