C15H17Cl2NO3 — CID 112525319
N-(2,6-dichlorophenyl)-1,4-dioxaspiro[4.5]decane-8-carboxamide (PubChem CID 112525319) has the molecular formula C15H17Cl2NO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-1,4-dioxaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-1,4-dioxaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 112525319 |
| Molecular Formula | C15H17Cl2NO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-(2,6-dichlorophenyl)-1,4-dioxaspiro[4.5]decane-8-carboxamide |
| SMILES | O=C(Nc1c(Cl)cccc1Cl)C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H17Cl2NO3/c16-11-2-1-3-12(17)13(11)18-14(19)10-4-6-15(7-5-10)20-8-9-21-15/h1-3,10H,4-9H2,(H,18,19) |
| InChIKey | LGTMMRSIYZLCME-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |