C14H16Cl2N2O — CID 65469174
N-(2,6-dichlorophenyl)-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 65469174) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 65469174 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-(2,6-dichlorophenyl)-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | O=C(Nc1c(Cl)cccc1Cl)C1CC12CCNCC2 |
| InChI | InChI=1S/C14H16Cl2N2O/c15-10-2-1-3-11(16)12(10)18-13(19)9-8-14(9)4-6-17-7-5-14/h1-3,9,17H,4-8H2,(H,18,19) |
| InChIKey | UPXGNHVAXHDVCA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |