C17H24Cl2N2O2 — CID 154900624
N-[2-(2-chloro-6-methylphenoxy)ethyl]-6-azaspiro[2.5]octane-2-carboxamide;hydrochloride (PubChem CID 154900624) has the molecular formula C17H24Cl2N2O2 and a molecular weight of 359.30 g/mol. Its IUPAC name is N-[2-(2-chloro-6-methylphenoxy)ethyl]-6-azaspiro[2.5]octane-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(2-chloro-6-methylphenoxy)ethyl]-6-azaspiro[2.5]octane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154900624 |
| Molecular Formula | C17H24Cl2N2O2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[2-(2-chloro-6-methylphenoxy)ethyl]-6-azaspiro[2.5]octane-2-carboxamide;hydrochloride |
| SMILES | Cc1cccc(Cl)c1OCCNC(=O)C1CC12CCNCC2.Cl |
| InChI | InChI=1S/C17H23ClN2O2.ClH/c1-12-3-2-4-14(18)15(12)22-10-9-20-16(21)13-11-17(13)5-7-19-8-6-17;/h2-4,13,19H,5-11H2,1H3,(H,20,21);1H |
| InChIKey | AQFXTDCTCPNWGM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|