C18H28Cl3N3O2 — CID 154894652
N-[2-(2-chlorophenoxy)ethyl]-2-methyl-2,8-diazaspiro[4.5]decane-3-carboxamide;dihydrochloride (PubChem CID 154894652) has the molecular formula C18H28Cl3N3O2 and a molecular weight of 424.80 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)ethyl]-2-methyl-2,8-diazaspiro[4.5]decane-3-carboxamide;dihydrochloride.
| Compound Name | N-[2-(2-chlorophenoxy)ethyl]-2-methyl-2,8-diazaspiro[4.5]decane-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 154894652 |
| Molecular Formula | C18H28Cl3N3O2 |
| Molecular Weight | 424.80 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | N-[2-(2-chlorophenoxy)ethyl]-2-methyl-2,8-diazaspiro[4.5]decane-3-carboxamide;dihydrochloride |
| SMILES | CN1CC2(CCNCC2)CC1C(=O)NCCOc1ccccc1Cl.Cl.Cl |
| InChI | InChI=1S/C18H26ClN3O2.2ClH/c1-22-13-18(6-8-20-9-7-18)12-15(22)17(23)21-10-11-24-16-5-3-2-4-14(16)19;;/h2-5,15,20H,6-13H2,1H3,(H,21,23);2*1H |
| InChIKey | MSXQGIMDMXBWLK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.80 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|