C16H25Cl2N3O2 — CID 119391836
3-(2-chlorophenoxy)-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride (PubChem CID 119391836) has the molecular formula C16H25Cl2N3O2 and a molecular weight of 362.30 g/mol. Its IUPAC name is 3-(2-chlorophenoxy)-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride.
| Compound Name | 3-(2-chlorophenoxy)-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119391836 |
| Molecular Formula | C16H25Cl2N3O2 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 3-(2-chlorophenoxy)-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride |
| SMILES | Cl.O=C(CCOc1ccccc1Cl)NCCCN1CCNCC1 |
| InChI | InChI=1S/C16H24ClN3O2.ClH/c17-14-4-1-2-5-15(14)22-13-6-16(21)19-7-3-10-20-11-8-18-9-12-20;/h1-2,4-5,18H,3,6-13H2,(H,19,21);1H |
| InChIKey | NGAVYEDTZNXNMR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|