C19H30ClNO2 — CID 108789478
3-(2-chlorophenoxy)-N-decylpropanamide (PubChem CID 108789478) has the molecular formula C19H30ClNO2 and a molecular weight of 339.91 g/mol. Its IUPAC name is 3-(2-chlorophenoxy)-N-decylpropanamide.
| Compound Name | 3-(2-chlorophenoxy)-N-decylpropanamide |
|---|---|
| PubChem CID | 108789478 |
| Molecular Formula | C19H30ClNO2 |
| Molecular Weight | 339.91 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 3-(2-chlorophenoxy)-N-decylpropanamide |
| SMILES | CCCCCCCCCCNC(=O)CCOc1ccccc1Cl |
| InChI | InChI=1S/C19H30ClNO2/c1-2-3-4-5-6-7-8-11-15-21-19(22)14-16-23-18-13-10-9-12-17(18)20/h9-10,12-13H,2-8,11,14-16H2,1H3,(H,21,22) |
| InChIKey | INVSOSDRCLLPAS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.91 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|