C17H28N4OS — CID 95876902
(3S)-2-methyl-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]-2,8-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 95876902) has the molecular formula C17H28N4OS and a molecular weight of 336.51 g/mol. Its IUPAC name is (3S)-2-methyl-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]-2,8-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | (3S)-2-methyl-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]-2,8-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 95876902 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (3S)-2-methyl-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]-2,8-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | Cc1ncsc1CCCNC(=O)[C@@H]1CC2(CCNCC2)CN1C |
| InChI | InChI=1S/C17H28N4OS/c1-13-15(23-12-20-13)4-3-7-19-16(22)14-10-17(11-21(14)2)5-8-18-9-6-17/h12,14,18H,3-11H2,1-2H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | LDIXTFNUTQUKBT-AWEZNQCLSA-N |
| XLogP | 1.57 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|