C18H27N5O2 — CID 95872736
(3R)-2-methyl-N-[2-(pyridine-3-carbonylamino)ethyl]-2,8-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 95872736) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is (3R)-2-methyl-N-[2-(pyridine-3-carbonylamino)ethyl]-2,8-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | (3R)-2-methyl-N-[2-(pyridine-3-carbonylamino)ethyl]-2,8-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 95872736 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | (3R)-2-methyl-N-[2-(pyridine-3-carbonylamino)ethyl]-2,8-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | CN1CC2(CCNCC2)C[C@@H]1C(=O)NCCNC(=O)c1cccnc1 |
| InChI | InChI=1S/C18H27N5O2/c1-23-13-18(4-7-19-8-5-18)11-15(23)17(25)22-10-9-21-16(24)14-3-2-6-20-12-14/h2-3,6,12,15,19H,4-5,7-11,13H2,1H3,(H,21,24)(H,22,25)/t15-/m1/s1 |
| InChIKey | NFGPQWCTXIEHOR-OAHLLOKOSA-N |
| XLogP | 0.00 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|