C20H31N3O2 — CID 56892746
N-[3-(2-methoxyphenyl)propyl]-2-methyl-2,8-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 56892746) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[3-(2-methoxyphenyl)propyl]-2-methyl-2,8-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | N-[3-(2-methoxyphenyl)propyl]-2-methyl-2,8-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 56892746 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | N-[3-(2-methoxyphenyl)propyl]-2-methyl-2,8-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | COc1ccccc1CCCNC(=O)C1CC2(CCNCC2)CN1C |
| InChI | InChI=1S/C20H31N3O2/c1-23-15-20(9-12-21-13-10-20)14-17(23)19(24)22-11-5-7-16-6-3-4-8-18(16)25-2/h3-4,6,8,17,21H,5,7,9-15H2,1-2H3,(H,22,24) |
| InChIKey | RHJJVUGRLZNRRF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|