C21H33N3O2 — CID 146043623
(4aR,8aR)-N-[3-(2-methoxyphenyl)propyl]-1,7-dimethyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxamide (PubChem CID 146043623) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is (4aR,8aR)-N-[3-(2-methoxyphenyl)propyl]-1,7-dimethyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxamide.
| Compound Name | (4aR,8aR)-N-[3-(2-methoxyphenyl)propyl]-1,7-dimethyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxamide |
|---|---|
| PubChem CID | 146043623 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | (4aR,8aR)-N-[3-(2-methoxyphenyl)propyl]-1,7-dimethyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxamide |
| SMILES | COc1ccccc1CCCNC(=O)[C@@]12CCCN(C)[C@H]1CN(C)CC2 |
| InChI | InChI=1S/C21H33N3O2/c1-23-15-12-21(11-7-14-24(2)19(21)16-23)20(25)22-13-6-9-17-8-4-5-10-18(17)26-3/h4-5,8,10,19H,6-7,9,11-16H2,1-3H3,(H,22,25)/t19-,21+/m0/s1 |
| InChIKey | COLXFXSDNCXBCC-PZJWPPBQSA-N |
| XLogP | 2.16 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|