C23H33N3O3 — CID 138807541
(4aR,8aR)-N-cyclobutyl-1-[2-(2-methoxyphenyl)acetyl]-7-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxamide (PubChem CID 138807541) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is (4aR,8aR)-N-cyclobutyl-1-[2-(2-methoxyphenyl)acetyl]-7-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxamide.
| Compound Name | (4aR,8aR)-N-cyclobutyl-1-[2-(2-methoxyphenyl)acetyl]-7-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxamide |
|---|---|
| PubChem CID | 138807541 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | (4aR,8aR)-N-cyclobutyl-1-[2-(2-methoxyphenyl)acetyl]-7-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxamide |
| SMILES | COc1ccccc1CC(=O)N1CCC[C@@]2(C(=O)NC3CCC3)CCN(C)C[C@H]12 |
| InChI | InChI=1S/C23H33N3O3/c1-25-14-12-23(22(28)24-18-8-5-9-18)11-6-13-26(20(23)16-25)21(27)15-17-7-3-4-10-19(17)29-2/h3-4,7,10,18,20H,5-6,8-9,11-16H2,1-2H3,(H,24,28)/t20-,23+/m0/s1 |
| InChIKey | YCVFKPOKXXYJQJ-NZQKXSOJSA-N |
| XLogP | 2.22 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |