C16H21NO4 — CID 79835759
methyl (2R)-1-[2-(2-methoxyphenyl)acetyl]piperidine-2-carboxylate (PubChem CID 79835759) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is methyl (2R)-1-[2-(2-methoxyphenyl)acetyl]piperidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[2-(2-methoxyphenyl)acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 79835759 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | methyl (2R)-1-[2-(2-methoxyphenyl)acetyl]piperidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCCN1C(=O)Cc1ccccc1OC |
| InChI | InChI=1S/C16H21NO4/c1-20-14-9-4-3-7-12(14)11-15(18)17-10-6-5-8-13(17)16(19)21-2/h3-4,7,9,13H,5-6,8,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | NVEPXCQUPZVUCO-CYBMUJFWSA-N |
| XLogP | 1.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |