C15H17Cl2NO3 — CID 115280064
methyl 1-[2-(2,4-dichlorophenyl)acetyl]piperidine-2-carboxylate (PubChem CID 115280064) has the molecular formula C15H17Cl2NO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is methyl 1-[2-(2,4-dichlorophenyl)acetyl]piperidine-2-carboxylate.
| Compound Name | methyl 1-[2-(2,4-dichlorophenyl)acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 115280064 |
| Molecular Formula | C15H17Cl2NO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | methyl 1-[2-(2,4-dichlorophenyl)acetyl]piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1C(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H17Cl2NO3/c1-21-15(20)13-4-2-3-7-18(13)14(19)8-10-5-6-11(16)9-12(10)17/h5-6,9,13H,2-4,7-8H2,1H3 |
| InChIKey | WUOSRSSEWWWUJZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |