C15H20N2O4 — CID 61106803
methyl 1-[2-(2-aminophenoxy)acetyl]piperidine-2-carboxylate (PubChem CID 61106803) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is methyl 1-[2-(2-aminophenoxy)acetyl]piperidine-2-carboxylate.
| Compound Name | methyl 1-[2-(2-aminophenoxy)acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 61106803 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | methyl 1-[2-(2-aminophenoxy)acetyl]piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1C(=O)COc1ccccc1N |
| InChI | InChI=1S/C15H20N2O4/c1-20-15(19)12-7-4-5-9-17(12)14(18)10-21-13-8-3-2-6-11(13)16/h2-3,6,8,12H,4-5,7,9-10,16H2,1H3 |
| InChIKey | VZXZQUVXJHLKRW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|