C21H33N3O2 — CID 95715961
(3S)-N-[3-(2-propoxyphenyl)propyl]-2,8-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 95715961) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is (3S)-N-[3-(2-propoxyphenyl)propyl]-2,8-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | (3S)-N-[3-(2-propoxyphenyl)propyl]-2,8-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 95715961 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | (3S)-N-[3-(2-propoxyphenyl)propyl]-2,8-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | CCCOc1ccccc1CCCNC(=O)[C@@H]1CC2(CCNCC2)CN1 |
| InChI | InChI=1S/C21H33N3O2/c1-2-14-26-19-8-4-3-6-17(19)7-5-11-23-20(25)18-15-21(16-24-18)9-12-22-13-10-21/h3-4,6,8,18,22,24H,2,5,7,9-16H2,1H3,(H,23,25)/t18-/m0/s1 |
| InChIKey | OLAVUSCADFQEOH-SFHVURJKSA-N |
| XLogP | 2.26 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|