C18H30ClN3O3 — CID 154913447
1-[(3R,4R)-3-hydroxypiperidin-4-yl]-3-[3-(2-propoxyphenyl)propyl]urea;hydrochloride (PubChem CID 154913447) has the molecular formula C18H30ClN3O3 and a molecular weight of 371.91 g/mol. Its IUPAC name is 1-[(3R,4R)-3-hydroxypiperidin-4-yl]-3-[3-(2-propoxyphenyl)propyl]urea;hydrochloride.
| Compound Name | 1-[(3R,4R)-3-hydroxypiperidin-4-yl]-3-[3-(2-propoxyphenyl)propyl]urea;hydrochloride |
|---|---|
| PubChem CID | 154913447 |
| Molecular Formula | C18H30ClN3O3 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-[(3R,4R)-3-hydroxypiperidin-4-yl]-3-[3-(2-propoxyphenyl)propyl]urea;hydrochloride |
| SMILES | CCCOc1ccccc1CCCNC(=O)N[C@@H]1CCNC[C@H]1O.Cl |
| InChI | InChI=1S/C18H29N3O3.ClH/c1-2-12-24-17-8-4-3-6-14(17)7-5-10-20-18(23)21-15-9-11-19-13-16(15)22;/h3-4,6,8,15-16,19,22H,2,5,7,9-13H2,1H3,(H2,20,21,23);1H/t15-,16-;/m1./s1 |
| InChIKey | SORWAJZYVOFTDY-QNBGGDODSA-N |
| XLogP | 1.85 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|