C13H20ClN3O2 — CID 154906200
1-benzyl-3-[(3R,4R)-3-hydroxypiperidin-4-yl]urea;hydrochloride (PubChem CID 154906200) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.77 g/mol. Its IUPAC name is 1-benzyl-3-[(3R,4R)-3-hydroxypiperidin-4-yl]urea;hydrochloride.
| Compound Name | 1-benzyl-3-[(3R,4R)-3-hydroxypiperidin-4-yl]urea;hydrochloride |
|---|---|
| PubChem CID | 154906200 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-benzyl-3-[(3R,4R)-3-hydroxypiperidin-4-yl]urea;hydrochloride |
| SMILES | Cl.O=C(NCc1ccccc1)N[C@@H]1CCNC[C@H]1O |
| InChI | InChI=1S/C13H19N3O2.ClH/c17-12-9-14-7-6-11(12)16-13(18)15-8-10-4-2-1-3-5-10;/h1-5,11-12,14,17H,6-9H2,(H2,15,16,18);1H/t11-,12-;/m1./s1 |
| InChIKey | LJVNWEPAUDBWDL-MNMPKAIFSA-N |
| XLogP | 0.63 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |