C20H30ClN3O4 — CID 69314997
benzyl N-[1-[(3-hydroxypiperidin-4-yl)carbamoyl]cyclohexyl]carbamate;hydrochloride (PubChem CID 69314997) has the molecular formula C20H30ClN3O4 and a molecular weight of 411.93 g/mol. Its IUPAC name is benzyl N-[1-[(3-hydroxypiperidin-4-yl)carbamoyl]cyclohexyl]carbamate;hydrochloride.
| Compound Name | benzyl N-[1-[(3-hydroxypiperidin-4-yl)carbamoyl]cyclohexyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 69314997 |
| Molecular Formula | C20H30ClN3O4 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | benzyl N-[1-[(3-hydroxypiperidin-4-yl)carbamoyl]cyclohexyl]carbamate;hydrochloride |
| SMILES | Cl.O=C(NC1(C(=O)NC2CCNCC2O)CCCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C20H29N3O4.ClH/c24-17-13-21-12-9-16(17)22-18(25)20(10-5-2-6-11-20)23-19(26)27-14-15-7-3-1-4-8-15;/h1,3-4,7-8,16-17,21,24H,2,5-6,9-14H2,(H,22,25)(H,23,26);1H |
| InChIKey | ZNQJIRJMESWMFK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |