C20H28N2O5 — CID 10690938
methyl (2S)-2-[[1-(phenylmethoxycarbonylamino)cycloheptanecarbonyl]amino]propanoate (PubChem CID 10690938) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is methyl (2S)-2-[[1-(phenylmethoxycarbonylamino)cycloheptanecarbonyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[1-(phenylmethoxycarbonylamino)cycloheptanecarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 10690938 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | methyl (2S)-2-[[1-(phenylmethoxycarbonylamino)cycloheptanecarbonyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)C1(NC(=O)OCc2ccccc2)CCCCCC1 |
| InChI | InChI=1S/C20H28N2O5/c1-15(17(23)26-2)21-18(24)20(12-8-3-4-9-13-20)22-19(25)27-14-16-10-6-5-7-11-16/h5-7,10-11,15H,3-4,8-9,12-14H2,1-2H3,(H,21,24)(H,22,25)/t15-/m0/s1 |
| InChIKey | HFLWPAGNOMLFQB-HNNXBMFYSA-N |
| XLogP | 2.68 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |