C20H31NO4Si — CID 23252917
2-trimethylsilylethyl 1-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylate (PubChem CID 23252917) has the molecular formula C20H31NO4Si and a molecular weight of 377.56 g/mol. Its IUPAC name is 2-trimethylsilylethyl 1-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl 1-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 23252917 |
| Molecular Formula | C20H31NO4Si |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-trimethylsilylethyl 1-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)C1(NC(=O)OCc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C20H31NO4Si/c1-26(2,3)15-14-24-18(22)20(12-8-5-9-13-20)21-19(23)25-16-17-10-6-4-7-11-17/h4,6-7,10-11H,5,8-9,12-16H2,1-3H3,(H,21,23) |
| InChIKey | VXBYQXHNBRWKOJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|