C19H30N2O4Si — CID 176596244
2-trimethylsilylethyl N-[1-methyl-3-(phenylmethoxycarbonylamino)cyclobutyl]carbamate (PubChem CID 176596244) has the molecular formula C19H30N2O4Si and a molecular weight of 378.55 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[1-methyl-3-(phenylmethoxycarbonylamino)cyclobutyl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[1-methyl-3-(phenylmethoxycarbonylamino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 176596244 |
| Molecular Formula | C19H30N2O4Si |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 2-trimethylsilylethyl N-[1-methyl-3-(phenylmethoxycarbonylamino)cyclobutyl]carbamate |
| SMILES | CC1(NC(=O)OCC[Si](C)(C)C)CC(NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C19H30N2O4Si/c1-19(21-18(23)24-10-11-26(2,3)4)12-16(13-19)20-17(22)25-14-15-8-6-5-7-9-15/h5-9,16H,10-14H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | MMKIBRDKCXWPBE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|