C23H38N2O5Si — CID 142754448
benzyl N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxycarbonylamino]cyclohexyl]carbamate (PubChem CID 142754448) has the molecular formula C23H38N2O5Si and a molecular weight of 450.65 g/mol. Its IUPAC name is benzyl N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxycarbonylamino]cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxycarbonylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 142754448 |
| Molecular Formula | C23H38N2O5Si |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | benzyl N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxycarbonylamino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OCCOC(=O)NC1CCC(NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H38N2O5Si/c1-23(2,3)31(4,5)30-16-15-28-21(26)24-19-11-13-20(14-12-19)25-22(27)29-17-18-9-7-6-8-10-18/h6-10,19-20H,11-17H2,1-5H3,(H,24,26)(H,25,27) |
| InChIKey | ADIXGFGJCQXONG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|