C27H37NO3SeSi — CID 10437033
benzyl N-[(1S,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylselanylcyclohept-4-en-1-yl]carbamate (PubChem CID 10437033) has the molecular formula C27H37NO3SeSi and a molecular weight of 530.64 g/mol. Its IUPAC name is benzyl N-[(1S,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylselanylcyclohept-4-en-1-yl]carbamate.
| Compound Name | benzyl N-[(1S,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylselanylcyclohept-4-en-1-yl]carbamate |
|---|---|
| PubChem CID | 10437033 |
| Molecular Formula | C27H37NO3SeSi |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | benzyl N-[(1S,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylselanylcyclohept-4-en-1-yl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H]([Se]c2ccccc2)C[C@@H](NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C27H37NO3SeSi/c1-27(2,3)33(4,5)31-23-16-17-25(32-24-14-10-7-11-15-24)19-22(18-23)28-26(29)30-20-21-12-8-6-9-13-21/h6-17,22-23,25H,18-20H2,1-5H3,(H,28,29)/t22-,23-,25-/m0/s1 |
| InChIKey | QWDQIQWQUZHFQY-LSQMVHIFSA-N |
| XLogP | 5.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|