C27H37NO4SeSi — CID 11757189
benzyl N-[(1S,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylseleninylcyclohept-4-en-1-yl]carbamate (PubChem CID 11757189) has the molecular formula C27H37NO4SeSi and a molecular weight of 546.64 g/mol. Its IUPAC name is benzyl N-[(1S,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylseleninylcyclohept-4-en-1-yl]carbamate.
| Compound Name | benzyl N-[(1S,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylseleninylcyclohept-4-en-1-yl]carbamate |
|---|---|
| PubChem CID | 11757189 |
| Molecular Formula | C27H37NO4SeSi |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | benzyl N-[(1S,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenylseleninylcyclohept-4-en-1-yl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@H]([Se](=O)c2ccccc2)C[C@@H](NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C27H37NO4SeSi/c1-27(2,3)34(4,5)32-23-16-17-25(33(30)24-14-10-7-11-15-24)19-22(18-23)28-26(29)31-20-21-12-8-6-9-13-21/h6-17,22-23,25H,18-20H2,1-5H3,(H,28,29)/t22-,23-,25-,33?/m0/s1 |
| InChIKey | SCRPTEABWYWBAW-GGXACUEYSA-N |
| XLogP | 5.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|