C15H17NO5 — CID 102074961
[(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 102074961) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 102074961 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C[C@@H](NC(=O)OCc2ccccc2)OC1 |
| InChI | InChI=1S/C15H17NO5/c1-11(17)21-13-7-8-14(19-10-13)16-15(18)20-9-12-5-3-2-4-6-12/h2-8,13-14H,9-10H2,1H3,(H,16,18)/t13-,14+/m1/s1 |
| InChIKey | UUPNIPQTSJERHL-KGLIPLIRSA-N |
| XLogP | 1.76 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|