About [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate
[(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 102074961) has the molecular formula C15H17NO5
and a molecular weight of 291.30 g/mol. Its IUPAC name is [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate.
Molecular Properties
| Compound Name | [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate |
| PubChem CID | 102074961 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C[C@@H](NC(=O)OCc2ccccc2)OC1 |
| InChI | InChI=1S/C15H17NO5/c1-11(17)21-13-7-8-14(19-10-13)16-15(18)20-9-12-5-3-2-4-6-12/h2-8,13-14H,9-10H2,1H3,(H,16,18)/t13-,14+/m1/s1 |
| InChIKey | UUPNIPQTSJERHL-KGLIPLIRSA-N |
| XLogP | 1.76 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate?
The IUPAC name of [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate (CID 102074961) is [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate.
What is the SMILES notation for [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate?
The canonical SMILES for [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate is CC(=O)O[C@@H]1C=C[C@@H](NC(=O)OCc2ccccc2)OC1.
What is the InChIKey of [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate?
The InChIKey is UUPNIPQTSJERHL-KGLIPLIRSA-N. The full InChI is InChI=1S/C15H17NO5/c1-11(17)21-13-7-8-14(19-10-13)16-15(18)20-9-12-5-3-2-4-6-12/h2-8,13-14H,9-10H2,1H3,(H,16,18)/t13-,14+/m1/s1.
What are the key properties of [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate?
[(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate has a molecular weight of 291.30 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,6S)-6-(phenylmethoxycarbonylamino)-3,6-dihydro-2H-pyran-3-yl] acetate is sourced from PubChem (CID 102074961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).