C13H14O3 — CID 102226049
[(3S,6R)-6-phenyl-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 102226049) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is [(3S,6R)-6-phenyl-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(3S,6R)-6-phenyl-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 102226049 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | [(3S,6R)-6-phenyl-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@H](c2ccccc2)OC1 |
| InChI | InChI=1S/C13H14O3/c1-10(14)16-12-7-8-13(15-9-12)11-5-3-2-4-6-11/h2-8,12-13H,9H2,1H3/t12-,13+/m0/s1 |
| InChIKey | OLLORHYEJGCZAO-QWHCGFSZSA-N |
| XLogP | 2.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|