C10H14O3 — CID 101107557
[(3S,6R)-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 101107557) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is [(3S,6R)-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(3S,6R)-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 101107557 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | [(3S,6R)-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | C=CC[C@@H]1C=C[C@H](OC(C)=O)CO1 |
| InChI | InChI=1S/C10H14O3/c1-3-4-9-5-6-10(7-12-9)13-8(2)11/h3,5-6,9-10H,1,4,7H2,2H3/t9-,10+/m1/s1 |
| InChIKey | SMBBYQFMDCGHNN-ZJUUUORDSA-N |
| XLogP | 1.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|