C15H20O9 — CID 170073091
(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-prop-2-enyloxane-2-carboxylic acid (PubChem CID 170073091) has the molecular formula C15H20O9 and a molecular weight of 344.32 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-prop-2-enyloxane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-prop-2-enyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 170073091 |
| Molecular Formula | C15H20O9 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-prop-2-enyloxane-2-carboxylic acid |
| SMILES | C=CC[C@H]1O[C@H](C(=O)O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H20O9/c1-5-6-10-11(21-7(2)16)12(22-8(3)17)13(23-9(4)18)14(24-10)15(19)20/h5,10-14H,1,6H2,2-4H3,(H,19,20)/t10-,11+,12-,13+,14+/m1/s1 |
| InChIKey | DGDNJWDYBRTPHS-BJJPWKGXSA-N |
| XLogP | 0.21 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|