C15H24O6 — CID 101101985
[(2S,3R,4S,5S)-5-acetyloxy-2-ethyl-4-methoxy-6-prop-2-enyloxan-3-yl] acetate (PubChem CID 101101985) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-5-acetyloxy-2-ethyl-4-methoxy-6-prop-2-enyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5S)-5-acetyloxy-2-ethyl-4-methoxy-6-prop-2-enyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 101101985 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [(2S,3R,4S,5S)-5-acetyloxy-2-ethyl-4-methoxy-6-prop-2-enyloxan-3-yl] acetate |
| SMILES | C=CCC1O[C@@H](CC)[C@@H](OC(C)=O)[C@H](OC)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H24O6/c1-6-8-12-14(20-10(4)17)15(18-5)13(19-9(3)16)11(7-2)21-12/h6,11-15H,1,7-8H2,2-5H3/t11-,12?,13+,14-,15-/m0/s1 |
| InChIKey | GXMYMYFAPWOROS-WRHJKRJHSA-N |
| XLogP | 1.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|