C15H23ClO4 — CID 162397376
[(2R,3R,5R)-5-[(2S,4R,5S)-4-chloro-5-prop-2-enyloxolan-2-yl]-2-ethyloxolan-3-yl] acetate (PubChem CID 162397376) has the molecular formula C15H23ClO4 and a molecular weight of 302.80 g/mol. Its IUPAC name is [(2R,3R,5R)-5-[(2S,4R,5S)-4-chloro-5-prop-2-enyloxolan-2-yl]-2-ethyloxolan-3-yl] acetate.
| Compound Name | [(2R,3R,5R)-5-[(2S,4R,5S)-4-chloro-5-prop-2-enyloxolan-2-yl]-2-ethyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 162397376 |
| Molecular Formula | C15H23ClO4 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [(2R,3R,5R)-5-[(2S,4R,5S)-4-chloro-5-prop-2-enyloxolan-2-yl]-2-ethyloxolan-3-yl] acetate |
| SMILES | C=CC[C@@H]1O[C@H]([C@H]2C[C@@H](OC(C)=O)[C@@H](CC)O2)C[C@H]1Cl |
| InChI | InChI=1S/C15H23ClO4/c1-4-6-12-10(16)7-13(20-12)15-8-14(18-9(3)17)11(5-2)19-15/h4,10-15H,1,5-8H2,2-3H3/t10-,11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | BRVGKJHAKGWGPI-PEZGRIKUSA-N |
| XLogP | 2.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|