C10H18O4 — CID 134194797
[(2R,3R,4R)-2-ethyl-6-hydroxy-3-methyloxan-4-yl] acetate (PubChem CID 134194797) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is [(2R,3R,4R)-2-ethyl-6-hydroxy-3-methyloxan-4-yl] acetate.
| Compound Name | [(2R,3R,4R)-2-ethyl-6-hydroxy-3-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 134194797 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | [(2R,3R,4R)-2-ethyl-6-hydroxy-3-methyloxan-4-yl] acetate |
| SMILES | CC[C@H]1OC(O)C[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C10H18O4/c1-4-8-6(2)9(13-7(3)11)5-10(12)14-8/h6,8-10,12H,4-5H2,1-3H3/t6-,8-,9-,10?/m1/s1 |
| InChIKey | BLNMUOHXHGZKCA-XIWVQZPPSA-N |
| XLogP | 1.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |