C11H20O3S — CID 158354110
[(2R,4S,5S)-6-ethyl-4,5-dimethyl-2-sulfanyloxan-3-yl] acetate (PubChem CID 158354110) has the molecular formula C11H20O3S and a molecular weight of 232.34 g/mol. Its IUPAC name is [(2R,4S,5S)-6-ethyl-4,5-dimethyl-2-sulfanyloxan-3-yl] acetate.
| Compound Name | [(2R,4S,5S)-6-ethyl-4,5-dimethyl-2-sulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 158354110 |
| Molecular Formula | C11H20O3S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | [(2R,4S,5S)-6-ethyl-4,5-dimethyl-2-sulfanyloxan-3-yl] acetate |
| SMILES | CCC1O[C@H](S)C(OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C11H20O3S/c1-5-9-6(2)7(3)10(11(15)14-9)13-8(4)12/h6-7,9-11,15H,5H2,1-4H3/t6-,7-,9?,10?,11+/m0/s1 |
| InChIKey | GXWUUUNKNYLSEB-NEAWIJRPSA-N |
| XLogP | 2.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|