C13H21NO7 — CID 67967713
[(2R,3S,4S,5R,6R)-2-acetyloxy-4-carbamoyloxy-6-ethyl-5-methyloxan-3-yl] acetate (PubChem CID 67967713) has the molecular formula C13H21NO7 and a molecular weight of 303.31 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-2-acetyloxy-4-carbamoyloxy-6-ethyl-5-methyloxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-2-acetyloxy-4-carbamoyloxy-6-ethyl-5-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 67967713 |
| Molecular Formula | C13H21NO7 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-2-acetyloxy-4-carbamoyloxy-6-ethyl-5-methyloxan-3-yl] acetate |
| SMILES | CC[C@H]1O[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(N)=O)[C@@H]1C |
| InChI | InChI=1S/C13H21NO7/c1-5-9-6(2)10(21-13(14)17)11(18-7(3)15)12(20-9)19-8(4)16/h6,9-12H,5H2,1-4H3,(H2,14,17)/t6-,9-,10+,11+,12+/m1/s1 |
| InChIKey | UJDTYWHUJFJQFX-FDMIMSKNSA-N |
| XLogP | 0.72 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|