C12H19BrO5 — CID 157456207
[(3R,4S,5S,6R)-3-acetyloxy-2-bromo-6-ethyl-5-methyloxan-4-yl] acetate (PubChem CID 157456207) has the molecular formula C12H19BrO5 and a molecular weight of 323.18 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-3-acetyloxy-2-bromo-6-ethyl-5-methyloxan-4-yl] acetate.
| Compound Name | [(3R,4S,5S,6R)-3-acetyloxy-2-bromo-6-ethyl-5-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 157456207 |
| Molecular Formula | C12H19BrO5 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | [(3R,4S,5S,6R)-3-acetyloxy-2-bromo-6-ethyl-5-methyloxan-4-yl] acetate |
| SMILES | CC[C@H]1OC(Br)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1C |
| InChI | InChI=1S/C12H19BrO5/c1-5-9-6(2)10(16-7(3)14)11(12(13)18-9)17-8(4)15/h6,9-12H,5H2,1-4H3/t6-,9+,10-,11+,12?/m0/s1 |
| InChIKey | HOIFSHVTGSECGA-AGHONVJYSA-N |
| XLogP | 2.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|