C8H15BrO — CID 59426770
(4R,5R)-2-bromo-5-ethyl-3,4-dimethyloxolane (PubChem CID 59426770) has the molecular formula C8H15BrO and a molecular weight of 207.11 g/mol. Its IUPAC name is (4R,5R)-2-bromo-5-ethyl-3,4-dimethyloxolane.
| Compound Name | (4R,5R)-2-bromo-5-ethyl-3,4-dimethyloxolane |
|---|---|
| PubChem CID | 59426770 |
| Molecular Formula | C8H15BrO |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | (4R,5R)-2-bromo-5-ethyl-3,4-dimethyloxolane |
| SMILES | CC[C@H]1OC(Br)C(C)[C@H]1C |
| InChI | InChI=1S/C8H15BrO/c1-4-7-5(2)6(3)8(9)10-7/h5-8H,4H2,1-3H3/t5-,6?,7-,8?/m1/s1 |
| InChIKey | MUZZEUPXQJLQCN-RYVOCIFZSA-N |
| XLogP | 2.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|