C11H21NO3 — CID 158170533
(2-amino-6-ethyl-4,5-dimethyloxan-3-yl) acetate (PubChem CID 158170533) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is (2-amino-6-ethyl-4,5-dimethyloxan-3-yl) acetate.
| Compound Name | (2-amino-6-ethyl-4,5-dimethyloxan-3-yl) acetate |
|---|---|
| PubChem CID | 158170533 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (2-amino-6-ethyl-4,5-dimethyloxan-3-yl) acetate |
| SMILES | CCC1OC(N)C(OC(C)=O)C(C)C1C |
| InChI | InChI=1S/C11H21NO3/c1-5-9-6(2)7(3)10(11(12)15-9)14-8(4)13/h6-7,9-11H,5,12H2,1-4H3 |
| InChIKey | AFNPSRHYZRETSP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |