C11H19FO3 — CID 71289777
(6-ethyl-3-(18F)fluoro-4,5-dimethyloxan-2-yl) acetate (PubChem CID 71289777) has the molecular formula C11H19FO3 and a molecular weight of 217.27 g/mol. Its IUPAC name is (6-ethyl-3-(18F)fluoro-4,5-dimethyloxan-2-yl) acetate.
| Compound Name | (6-ethyl-3-(18F)fluoro-4,5-dimethyloxan-2-yl) acetate |
|---|---|
| PubChem CID | 71289777 |
| Molecular Formula | C11H19FO3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (6-ethyl-3-(18F)fluoro-4,5-dimethyloxan-2-yl) acetate |
| SMILES | CCC1OC(OC(C)=O)C([18F])C(C)C1C |
| InChI | InChI=1S/C11H19FO3/c1-5-9-6(2)7(3)10(12)11(15-9)14-8(4)13/h6-7,9-11H,5H2,1-4H3/i12-1 |
| InChIKey | ICQRWXWLYWAHMP-DWSYCVKZSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |