C12H19F3O6S — CID 118121691
[(2S,4S,5S)-6-ethyl-4,5-dimethyl-3-(trifluoromethoxysulfonyl)oxan-2-yl] acetate (PubChem CID 118121691) has the molecular formula C12H19F3O6S and a molecular weight of 348.34 g/mol. Its IUPAC name is [(2S,4S,5S)-6-ethyl-4,5-dimethyl-3-(trifluoromethoxysulfonyl)oxan-2-yl] acetate.
| Compound Name | [(2S,4S,5S)-6-ethyl-4,5-dimethyl-3-(trifluoromethoxysulfonyl)oxan-2-yl] acetate |
|---|---|
| PubChem CID | 118121691 |
| Molecular Formula | C12H19F3O6S |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | [(2S,4S,5S)-6-ethyl-4,5-dimethyl-3-(trifluoromethoxysulfonyl)oxan-2-yl] acetate |
| SMILES | CCC1O[C@@H](OC(C)=O)C(S(=O)(=O)OC(F)(F)F)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C12H19F3O6S/c1-5-9-6(2)7(3)10(11(20-9)19-8(4)16)22(17,18)21-12(13,14)15/h6-7,9-11H,5H2,1-4H3/t6-,7-,9?,10?,11+/m0/s1 |
| InChIKey | QGIOQAIULBQPRJ-NEAWIJRPSA-N |
| XLogP | 2.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|