C23H38O9 — CID 58498448
[(3S,4R,6S)-3-[(2S,4R,5S)-4,5-diacetyloxy-6-ethyl-3-methyloxan-2-yl]oxy-2-ethyl-5,6-dimethyloxan-4-yl] acetate (PubChem CID 58498448) has the molecular formula C23H38O9 and a molecular weight of 458.55 g/mol. Its IUPAC name is [(3S,4R,6S)-3-[(2S,4R,5S)-4,5-diacetyloxy-6-ethyl-3-methyloxan-2-yl]oxy-2-ethyl-5,6-dimethyloxan-4-yl] acetate.
| Compound Name | [(3S,4R,6S)-3-[(2S,4R,5S)-4,5-diacetyloxy-6-ethyl-3-methyloxan-2-yl]oxy-2-ethyl-5,6-dimethyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 58498448 |
| Molecular Formula | C23H38O9 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | [(3S,4R,6S)-3-[(2S,4R,5S)-4,5-diacetyloxy-6-ethyl-3-methyloxan-2-yl]oxy-2-ethyl-5,6-dimethyloxan-4-yl] acetate |
| SMILES | CCC1O[C@@H](O[C@H]2C(CC)O[C@@H](C)C(C)[C@H]2OC(C)=O)C(C)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H38O9/c1-9-17-22(19(28-14(6)24)11(3)13(5)27-17)32-23-12(4)20(29-15(7)25)21(30-16(8)26)18(10-2)31-23/h11-13,17-23H,9-10H2,1-8H3/t11?,12?,13-,17?,18?,19+,20+,21-,22-,23-/m0/s1 |
| InChIKey | FSROVSZYBJJITL-GKWROMDGSA-N |
| XLogP | 2.77 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|