C10H15FO5 — CID 58049083
[(2R,3S)-5-acetyloxy-2-ethyl-4-fluorooxolan-3-yl] acetate (PubChem CID 58049083) has the molecular formula C10H15FO5 and a molecular weight of 234.22 g/mol. Its IUPAC name is [(2R,3S)-5-acetyloxy-2-ethyl-4-fluorooxolan-3-yl] acetate.
| Compound Name | [(2R,3S)-5-acetyloxy-2-ethyl-4-fluorooxolan-3-yl] acetate |
|---|---|
| PubChem CID | 58049083 |
| Molecular Formula | C10H15FO5 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | [(2R,3S)-5-acetyloxy-2-ethyl-4-fluorooxolan-3-yl] acetate |
| SMILES | CC[C@H]1OC(OC(C)=O)C(F)[C@H]1OC(C)=O |
| InChI | InChI=1S/C10H15FO5/c1-4-7-9(14-5(2)12)8(11)10(16-7)15-6(3)13/h7-10H,4H2,1-3H3/t7-,8?,9+,10?/m1/s1 |
| InChIKey | YULHGILQLUQVCZ-RJQCTPFPSA-N |
| XLogP | 0.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |