C18H26O6S — CID 58419243
[(3R,4S,5S,6R)-6-ethyl-4,5-dimethyl-3-(4-methylphenyl)sulfonyloxyoxan-2-yl] acetate (PubChem CID 58419243) has the molecular formula C18H26O6S and a molecular weight of 370.47 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-6-ethyl-4,5-dimethyl-3-(4-methylphenyl)sulfonyloxyoxan-2-yl] acetate.
| Compound Name | [(3R,4S,5S,6R)-6-ethyl-4,5-dimethyl-3-(4-methylphenyl)sulfonyloxyoxan-2-yl] acetate |
|---|---|
| PubChem CID | 58419243 |
| Molecular Formula | C18H26O6S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [(3R,4S,5S,6R)-6-ethyl-4,5-dimethyl-3-(4-methylphenyl)sulfonyloxyoxan-2-yl] acetate |
| SMILES | CC[C@H]1OC(OC(C)=O)[C@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C18H26O6S/c1-6-16-12(3)13(4)17(18(23-16)22-14(5)19)24-25(20,21)15-9-7-11(2)8-10-15/h7-10,12-13,16-18H,6H2,1-5H3/t12-,13-,16+,17+,18?/m0/s1 |
| InChIKey | DVKCFEBKDMNVMZ-PUCQRQGNSA-N |
| XLogP | 3.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|