C18H24O7S — CID 58503410
[(2R,3S,4S,5S)-5-methyl-3-(4-methylphenyl)sulfonyloxy-4-prop-1-en-2-yloxyoxolan-2-yl]methyl acetate (PubChem CID 58503410) has the molecular formula C18H24O7S and a molecular weight of 384.45 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-5-methyl-3-(4-methylphenyl)sulfonyloxy-4-prop-1-en-2-yloxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5S)-5-methyl-3-(4-methylphenyl)sulfonyloxy-4-prop-1-en-2-yloxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58503410 |
| Molecular Formula | C18H24O7S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [(2R,3S,4S,5S)-5-methyl-3-(4-methylphenyl)sulfonyloxy-4-prop-1-en-2-yloxyoxolan-2-yl]methyl acetate |
| SMILES | C=C(C)O[C@@H]1[C@@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H](COC(C)=O)O[C@H]1C |
| InChI | InChI=1S/C18H24O7S/c1-11(2)23-17-13(4)24-16(10-22-14(5)19)18(17)25-26(20,21)15-8-6-12(3)7-9-15/h6-9,13,16-18H,1,10H2,2-5H3/t13-,16+,17-,18-/m0/s1 |
| InChIKey | GMTCXDWBKUXYMV-NBMRYCAZSA-N |
| XLogP | 2.34 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|