C27H38O12S2 — CID 22812654
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[6-(4-methylphenyl)sulfonyloxyhexylsulfanyl]oxan-2-yl]methyl acetate (PubChem CID 22812654) has the molecular formula C27H38O12S2 and a molecular weight of 618.72 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[6-(4-methylphenyl)sulfonyloxyhexylsulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[6-(4-methylphenyl)sulfonyloxyhexylsulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22812654 |
| Molecular Formula | C27H38O12S2 |
| Molecular Weight | 618.72 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[6-(4-methylphenyl)sulfonyloxyhexylsulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SCCCCCCOS(=O)(=O)c2ccc(C)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H38O12S2/c1-17-10-12-22(13-11-17)41(32,33)35-14-8-6-7-9-15-40-27-26(38-21(5)31)25(37-20(4)30)24(36-19(3)29)23(39-27)16-34-18(2)28/h10-13,23-27H,6-9,14-16H2,1-5H3/t23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | SDJSCHJLUFORTK-SEFGFODJSA-N |
| XLogP | 3.08 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.72 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|