C19H28O7S — CID 118155691
[(2S,3S,4R,5S,6S)-4,5,6-trimethyl-2-[2-(4-methylphenyl)sulfonyloxyethoxy]oxan-3-yl] acetate (PubChem CID 118155691) has the molecular formula C19H28O7S and a molecular weight of 400.49 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6S)-4,5,6-trimethyl-2-[2-(4-methylphenyl)sulfonyloxyethoxy]oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5S,6S)-4,5,6-trimethyl-2-[2-(4-methylphenyl)sulfonyloxyethoxy]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 118155691 |
| Molecular Formula | C19H28O7S |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [(2S,3S,4R,5S,6S)-4,5,6-trimethyl-2-[2-(4-methylphenyl)sulfonyloxyethoxy]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OCCOS(=O)(=O)c2ccc(C)cc2)O[C@@H](C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C19H28O7S/c1-12-6-8-17(9-7-12)27(21,22)24-11-10-23-19-18(26-16(5)20)14(3)13(2)15(4)25-19/h6-9,13-15,18-19H,10-11H2,1-5H3/t13-,14+,15-,18-,19-/m0/s1 |
| InChIKey | QQWKHEFFDVXVAZ-HZMZCJTDSA-N |
| XLogP | 2.67 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|