C12H20O5 — CID 71182491
[(3S,5S,6S)-2-acetyloxy-4,5,6-trimethyloxan-3-yl] acetate (PubChem CID 71182491) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is [(3S,5S,6S)-2-acetyloxy-4,5,6-trimethyloxan-3-yl] acetate.
| Compound Name | [(3S,5S,6S)-2-acetyloxy-4,5,6-trimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 71182491 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [(3S,5S,6S)-2-acetyloxy-4,5,6-trimethyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@@H](C)[C@@H](C)C(C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H20O5/c1-6-7(2)11(16-9(4)13)12(15-8(6)3)17-10(5)14/h6-8,11-12H,1-5H3/t6-,7?,8-,11-,12?/m0/s1 |
| InChIKey | BMPIMKBKXQNWQH-SAFSGMNQSA-N |
| XLogP | 1.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |