C15H28O5S2 — CID 130327848
[(2R,4S,5S)-6-ethyl-2-[2-(2-hydroxyethyldisulfanyl)ethoxy]-4,5-dimethyloxan-3-yl] acetate (PubChem CID 130327848) has the molecular formula C15H28O5S2 and a molecular weight of 352.52 g/mol. Its IUPAC name is [(2R,4S,5S)-6-ethyl-2-[2-(2-hydroxyethyldisulfanyl)ethoxy]-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [(2R,4S,5S)-6-ethyl-2-[2-(2-hydroxyethyldisulfanyl)ethoxy]-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 130327848 |
| Molecular Formula | C15H28O5S2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [(2R,4S,5S)-6-ethyl-2-[2-(2-hydroxyethyldisulfanyl)ethoxy]-4,5-dimethyloxan-3-yl] acetate |
| SMILES | CCC1O[C@@H](OCCSSCCO)C(OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C15H28O5S2/c1-5-13-10(2)11(3)14(19-12(4)17)15(20-13)18-7-9-22-21-8-6-16/h10-11,13-16H,5-9H2,1-4H3/t10-,11-,13?,14?,15+/m0/s1 |
| InChIKey | LIAXWMVLAROMBE-XSIDXRKQSA-N |
| XLogP | 2.72 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|